C29H30N4O4 — CID 172676721
(1S,3R)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-2-[(4-methoxyphenyl)methyl]-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide (PubChem CID 172676721) has the molecular formula C29H30N4O4 and a molecular weight of 498.58 g/mol. Its IUPAC name is (1S,3R)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-2-[(4-methoxyphenyl)methyl]-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide.
| Compound Name | (1S,3R)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-2-[(4-methoxyphenyl)methyl]-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 172676721 |
| Molecular Formula | C29H30N4O4 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | (1S,3R)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-2-[(4-methoxyphenyl)methyl]-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide |
| SMILES | COc1ccc(CN2[C@@H](C(=O)NCc3ccc(C(=O)NO)cc3)Cc3c([nH]c4ccccc34)[C@@H]2C)cc1 |
| InChI | InChI=1S/C29H30N4O4/c1-18-27-24(23-5-3-4-6-25(23)31-27)15-26(33(18)17-20-9-13-22(37-2)14-10-20)29(35)30-16-19-7-11-21(12-8-19)28(34)32-36/h3-14,18,26,31,36H,15-17H2,1-2H3,(H,30,35)(H,32,34)/t18-,26+/m0/s1 |
| InChIKey | QVOLRHFIVLLKJX-HFJWLAOPSA-N |
| XLogP | 4.10 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|