C31H39N7O3 — CID 46703600
methyl (1S,3S)-2-[4,6-bis(butylamino)-1,3,5-triazin-2-yl]-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 46703600) has the molecular formula C31H39N7O3 and a molecular weight of 557.70 g/mol. Its IUPAC name is methyl (1S,3S)-2-[4,6-bis(butylamino)-1,3,5-triazin-2-yl]-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (1S,3S)-2-[4,6-bis(butylamino)-1,3,5-triazin-2-yl]-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 46703600 |
| Molecular Formula | C31H39N7O3 |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.31 |
| IUPAC Name | methyl (1S,3S)-2-[4,6-bis(butylamino)-1,3,5-triazin-2-yl]-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCCCNc1nc(NCCCC)nc(N2[C@@H](c3ccc(OC)cc3)c3[nH]c4ccccc4c3C[C@H]2C(=O)OC)n1 |
| InChI | InChI=1S/C31H39N7O3/c1-5-7-17-32-29-35-30(33-18-8-6-2)37-31(36-29)38-25(28(39)41-4)19-23-22-11-9-10-12-24(22)34-26(23)27(38)20-13-15-21(40-3)16-14-20/h9-16,25,27,34H,5-8,17-19H2,1-4H3,(H2,32,33,35,36,37)/t25-,27-/m0/s1 |
| InChIKey | CWIYRAGNBZATHR-BDYUSTAISA-N |
| XLogP | 5.48 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|