C37H38N6O5Si — CID 176853204
methyl 6-(2-ethoxypyrimidin-5-yl)-1-[4-(2-ethoxypyrimidin-5-yl)phenyl]-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 176853204) has the molecular formula C37H38N6O5Si and a molecular weight of 674.83 g/mol. Its IUPAC name is methyl 6-(2-ethoxypyrimidin-5-yl)-1-[4-(2-ethoxypyrimidin-5-yl)phenyl]-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 6-(2-ethoxypyrimidin-5-yl)-1-[4-(2-ethoxypyrimidin-5-yl)phenyl]-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 176853204 |
| Molecular Formula | C37H38N6O5Si |
| Molecular Weight | 674.83 g/mol |
| Exact Mass | 674.27 |
| IUPAC Name | methyl 6-(2-ethoxypyrimidin-5-yl)-1-[4-(2-ethoxypyrimidin-5-yl)phenyl]-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCOc1ncc(-c2ccc(C3c4[nH]c5ccc(-c6cnc(OCC)nc6)cc5c4CC(C(=O)OC)N3C(=O)C#C[Si](C)(C)C)cc2)cn1 |
| InChI | InChI=1S/C37H38N6O5Si/c1-7-47-36-38-19-26(20-39-36)23-9-11-24(12-10-23)34-33-29(18-31(35(45)46-3)43(34)32(44)15-16-49(4,5)6)28-17-25(13-14-30(28)42-33)27-21-40-37(41-22-27)48-8-2/h9-14,17,19-22,31,34,42H,7-8,18H2,1-6H3 |
| InChIKey | WFASFRBLKOVRDJ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.83 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|