C22H18ClFN2O5 — CID 53237233
methyl 1-(1,3-benzodioxol-5-yl)-2-(2-chloroacetyl)-7-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 53237233) has the molecular formula C22H18ClFN2O5 and a molecular weight of 444.85 g/mol. Its IUPAC name is methyl 1-(1,3-benzodioxol-5-yl)-2-(2-chloroacetyl)-7-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 1-(1,3-benzodioxol-5-yl)-2-(2-chloroacetyl)-7-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 53237233 |
| Molecular Formula | C22H18ClFN2O5 |
| Molecular Weight | 444.85 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | methyl 1-(1,3-benzodioxol-5-yl)-2-(2-chloroacetyl)-7-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)C1Cc2c([nH]c3cc(F)ccc23)C(c2ccc3c(c2)OCO3)N1C(=O)CCl |
| InChI | InChI=1S/C22H18ClFN2O5/c1-29-22(28)16-8-14-13-4-3-12(24)7-15(13)25-20(14)21(26(16)19(27)9-23)11-2-5-17-18(6-11)31-10-30-17/h2-7,16,21,25H,8-10H2,1H3 |
| InChIKey | VMMWGLRTRMVAQK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.85 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|