C29H25ClN2O6 — CID 59120492
methyl (1R,3R)-1-(1,3-benzodioxol-5-yl)-2-(2-chloroacetyl)-8-phenylmethoxy-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 59120492) has the molecular formula C29H25ClN2O6 and a molecular weight of 532.98 g/mol. Its IUPAC name is methyl (1R,3R)-1-(1,3-benzodioxol-5-yl)-2-(2-chloroacetyl)-8-phenylmethoxy-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (1R,3R)-1-(1,3-benzodioxol-5-yl)-2-(2-chloroacetyl)-8-phenylmethoxy-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 59120492 |
| Molecular Formula | C29H25ClN2O6 |
| Molecular Weight | 532.98 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | methyl (1R,3R)-1-(1,3-benzodioxol-5-yl)-2-(2-chloroacetyl)-8-phenylmethoxy-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)[C@H]1Cc2c([nH]c3c(OCc4ccccc4)cccc23)[C@@H](c2ccc3c(c2)OCO3)N1C(=O)CCl |
| InChI | InChI=1S/C29H25ClN2O6/c1-35-29(34)21-13-20-19-8-5-9-23(36-15-17-6-3-2-4-7-17)26(19)31-27(20)28(32(21)25(33)14-30)18-10-11-22-24(12-18)38-16-37-22/h2-12,21,28,31H,13-16H2,1H3/t21-,28-/m1/s1 |
| InChIKey | FCUJCOXBBWWWFI-LYZGTLIUSA-N |
| XLogP | 4.73 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.98 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|