C32H29N3O8 — CID 58619978
benzyl (4R)-4-[(1R,3R)-1-(1,3-benzodioxol-5-yl)-3-methoxycarbonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 58619978) has the molecular formula C32H29N3O8 and a molecular weight of 583.60 g/mol. Its IUPAC name is benzyl (4R)-4-[(1R,3R)-1-(1,3-benzodioxol-5-yl)-3-methoxycarbonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (4R)-4-[(1R,3R)-1-(1,3-benzodioxol-5-yl)-3-methoxycarbonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 58619978 |
| Molecular Formula | C32H29N3O8 |
| Molecular Weight | 583.60 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | benzyl (4R)-4-[(1R,3R)-1-(1,3-benzodioxol-5-yl)-3-methoxycarbonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc3c(c2)OCO3)N1C(=O)[C@H]1COCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H29N3O8/c1-39-31(37)24-14-22-21-9-5-6-10-23(21)33-28(22)29(20-11-12-26-27(13-20)43-18-42-26)35(24)30(36)25-16-40-17-34(25)32(38)41-15-19-7-3-2-4-8-19/h2-13,24-25,29,33H,14-18H2,1H3/t24-,25-,29-/m1/s1 |
| InChIKey | VIEXDVUKCCUFOE-ITLAICGJSA-N |
| XLogP | 3.91 |
| TPSA | 119.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.60 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|