C22H17Cl3N2O5 — CID 175673437
methyl (1R,3R)-1-(1,3-benzodioxol-5-yl)-2-(2,2,2-trichloroacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 175673437) has the molecular formula C22H17Cl3N2O5 and a molecular weight of 495.75 g/mol. Its IUPAC name is methyl (1R,3R)-1-(1,3-benzodioxol-5-yl)-2-(2,2,2-trichloroacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (1R,3R)-1-(1,3-benzodioxol-5-yl)-2-(2,2,2-trichloroacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 175673437 |
| Molecular Formula | C22H17Cl3N2O5 |
| Molecular Weight | 495.75 g/mol |
| Exact Mass | 494.02 |
| IUPAC Name | methyl (1R,3R)-1-(1,3-benzodioxol-5-yl)-2-(2,2,2-trichloroacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)[C@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc3c(c2)OCO3)N1C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C22H17Cl3N2O5/c1-30-20(28)15-9-13-12-4-2-3-5-14(12)26-18(13)19(27(15)21(29)22(23,24)25)11-6-7-16-17(8-11)32-10-31-16/h2-8,15,19,26H,9-10H2,1H3/t15-,19-/m1/s1 |
| InChIKey | NXCKBOFXLJPFKG-DNVCBOLYSA-N |
| XLogP | 4.28 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.75 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|