C13H15NO5 — CID 14630870
3-O-benzyl 4-O-methyl (4S)-1,3-oxazolidine-3,4-dicarboxylate (PubChem CID 14630870) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is 3-O-benzyl 4-O-methyl (4S)-1,3-oxazolidine-3,4-dicarboxylate.
| Compound Name | 3-O-benzyl 4-O-methyl (4S)-1,3-oxazolidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 14630870 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 3-O-benzyl 4-O-methyl (4S)-1,3-oxazolidine-3,4-dicarboxylate |
| SMILES | COC(=O)[C@@H]1COCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H15NO5/c1-17-12(15)11-8-18-9-14(11)13(16)19-7-10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3/t11-/m0/s1 |
| InChIKey | KAUPOLAFYURMQR-NSHDSACASA-N |
| XLogP | 1.15 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |