C18H24N2O4 — CID 15487455
benzyl (4S)-4-[(E)-3-(diethylamino)prop-2-enoyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 15487455) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is benzyl (4S)-4-[(E)-3-(diethylamino)prop-2-enoyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (4S)-4-[(E)-3-(diethylamino)prop-2-enoyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 15487455 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | benzyl (4S)-4-[(E)-3-(diethylamino)prop-2-enoyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CCN(/C=C/C(=O)[C@@H]1COCN1C(=O)OCc1ccccc1)CC |
| InChI | InChI=1S/C18H24N2O4/c1-3-19(4-2)11-10-17(21)16-13-23-14-20(16)18(22)24-12-15-8-6-5-7-9-15/h5-11,16H,3-4,12-14H2,1-2H3/b11-10+/t16-/m0/s1 |
| InChIKey | VDRONSAHHVUQOC-OFAQMXQXSA-N |
| XLogP | 2.41 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|