C16H21NO5 — CID 57109367
5-(3-phenylmethoxycarbonyl-1,3-oxazolidin-4-yl)pentanoic acid (PubChem CID 57109367) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is 5-(3-phenylmethoxycarbonyl-1,3-oxazolidin-4-yl)pentanoic acid.
| Compound Name | 5-(3-phenylmethoxycarbonyl-1,3-oxazolidin-4-yl)pentanoic acid |
|---|---|
| PubChem CID | 57109367 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 5-(3-phenylmethoxycarbonyl-1,3-oxazolidin-4-yl)pentanoic acid |
| SMILES | O=C(O)CCCCC1COCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H21NO5/c18-15(19)9-5-4-8-14-11-21-12-17(14)16(20)22-10-13-6-2-1-3-7-13/h1-3,6-7,14H,4-5,8-12H2,(H,18,19) |
| InChIKey | UWJUKAFCDZIRTC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|