C16H19NO6 — CID 139786436
5-[(4R)-5-oxo-3-phenylmethoxycarbonyl-1,3-oxazolidin-4-yl]pentanoic acid (PubChem CID 139786436) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is 5-[(4R)-5-oxo-3-phenylmethoxycarbonyl-1,3-oxazolidin-4-yl]pentanoic acid.
| Compound Name | 5-[(4R)-5-oxo-3-phenylmethoxycarbonyl-1,3-oxazolidin-4-yl]pentanoic acid |
|---|---|
| PubChem CID | 139786436 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 5-[(4R)-5-oxo-3-phenylmethoxycarbonyl-1,3-oxazolidin-4-yl]pentanoic acid |
| SMILES | O=C(O)CCCC[C@@H]1C(=O)OCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H19NO6/c18-14(19)9-5-4-8-13-15(20)23-11-17(13)16(21)22-10-12-6-2-1-3-7-12/h1-3,6-7,13H,4-5,8-11H2,(H,18,19)/t13-/m1/s1 |
| InChIKey | SHNFHXXTISOWTG-CYBMUJFWSA-N |
| XLogP | 2.15 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|