C17H24NO6P — CID 67742203
benzyl (4S)-4-(2-diethoxyphosphanylethyl)-5-oxo-1,3-oxazolidine-3-carboxylate (PubChem CID 67742203) has the molecular formula C17H24NO6P and a molecular weight of 369.35 g/mol. Its IUPAC name is benzyl (4S)-4-(2-diethoxyphosphanylethyl)-5-oxo-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (4S)-4-(2-diethoxyphosphanylethyl)-5-oxo-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 67742203 |
| Molecular Formula | C17H24NO6P |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | benzyl (4S)-4-(2-diethoxyphosphanylethyl)-5-oxo-1,3-oxazolidine-3-carboxylate |
| SMILES | CCOP(CC[C@H]1C(=O)OCN1C(=O)OCc1ccccc1)OCC |
| InChI | InChI=1S/C17H24NO6P/c1-3-23-25(24-4-2)11-10-15-16(19)22-13-18(15)17(20)21-12-14-8-6-5-7-9-14/h5-9,15H,3-4,10-13H2,1-2H3/t15-/m0/s1 |
| InChIKey | WLOQHOUOTJNVJK-HNNXBMFYSA-N |
| XLogP | 3.28 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|