C16H21NO6 — CID 59168843
benzyl 4-(3,3-dimethoxypropyl)-5-oxo-1,3-oxazolidine-3-carboxylate (PubChem CID 59168843) has the molecular formula C16H21NO6 and a molecular weight of 323.34 g/mol. Its IUPAC name is benzyl 4-(3,3-dimethoxypropyl)-5-oxo-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl 4-(3,3-dimethoxypropyl)-5-oxo-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 59168843 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | benzyl 4-(3,3-dimethoxypropyl)-5-oxo-1,3-oxazolidine-3-carboxylate |
| SMILES | COC(CCC1C(=O)OCN1C(=O)OCc1ccccc1)OC |
| InChI | InChI=1S/C16H21NO6/c1-20-14(21-2)9-8-13-15(18)23-11-17(13)16(19)22-10-12-6-4-3-5-7-12/h3-7,13-14H,8-11H2,1-2H3 |
| InChIKey | OAXMDBUTOAGDJI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|