benzyl 4-methyl-5-oxo-1,3-oxazolidine-3-carboxylate

C12H13NO4 — CID 3982420

IUPACbenzyl 4-methyl-5-oxo-1,3-oxazolidine-3-carboxylate
SMILESCC1C(=O)OCN1C(=O)OCc1ccccc1
InChIInChI=1S/C12H13NO4/c1-9-11(14)17-8-13(9)12(15)16-7-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3
InChIKeyRPPNACKXIUVYEF-UHFFFAOYSA-N
MW235.24 g/mol
LogP1.53
Rot. Bonds2

About benzyl 4-methyl-5-oxo-1,3-oxazolidine-3-carboxylate

benzyl 4-methyl-5-oxo-1,3-oxazolidine-3-carboxylate (PubChem CID 3982420) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is benzyl 4-methyl-5-oxo-1,3-oxazolidine-3-carboxylate.

Molecular Properties

Compound Namebenzyl 4-methyl-5-oxo-1,3-oxazolidine-3-carboxylate
PubChem CID3982420
Molecular FormulaC12H13NO4
Molecular Weight235.24 g/mol
Exact Mass235.08
IUPAC Namebenzyl 4-methyl-5-oxo-1,3-oxazolidine-3-carboxylate
SMILESCC1C(=O)OCN1C(=O)OCc1ccccc1
InChIInChI=1S/C12H13NO4/c1-9-11(14)17-8-13(9)12(15)16-7-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3
InChIKeyRPPNACKXIUVYEF-UHFFFAOYSA-N
XLogP1.53
TPSA55.84 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.24
LogP ≤ 51.53
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze benzyl 4-methyl-5-oxo-1,3-oxazolidine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 4-methyl-5-oxo-1,3-oxazolidine-3-carboxylate?
The IUPAC name of benzyl 4-methyl-5-oxo-1,3-oxazolidine-3-carboxylate (CID 3982420) is benzyl 4-methyl-5-oxo-1,3-oxazolidine-3-carboxylate.
What is the SMILES notation for benzyl 4-methyl-5-oxo-1,3-oxazolidine-3-carboxylate?
The canonical SMILES for benzyl 4-methyl-5-oxo-1,3-oxazolidine-3-carboxylate is CC1C(=O)OCN1C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 4-methyl-5-oxo-1,3-oxazolidine-3-carboxylate?
The InChIKey is RPPNACKXIUVYEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO4/c1-9-11(14)17-8-13(9)12(15)16-7-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3.
What are the key properties of benzyl 4-methyl-5-oxo-1,3-oxazolidine-3-carboxylate?
benzyl 4-methyl-5-oxo-1,3-oxazolidine-3-carboxylate has a molecular weight of 235.24 g/mol, XLogP of 1.53, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-methyl-5-oxo-1,3-oxazolidine-3-carboxylate is sourced from PubChem (CID 3982420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).