C12H13NO4S — CID 101064250
benzyl (4R)-5-oxo-4-(sulfanylmethyl)-1,3-oxazolidine-3-carboxylate (PubChem CID 101064250) has the molecular formula C12H13NO4S and a molecular weight of 267.31 g/mol. Its IUPAC name is benzyl (4R)-5-oxo-4-(sulfanylmethyl)-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (4R)-5-oxo-4-(sulfanylmethyl)-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 101064250 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | benzyl (4R)-5-oxo-4-(sulfanylmethyl)-1,3-oxazolidine-3-carboxylate |
| SMILES | O=C1OCN(C(=O)OCc2ccccc2)[C@H]1CS |
| InChI | InChI=1S/C12H13NO4S/c14-11-10(7-18)13(8-17-11)12(15)16-6-9-4-2-1-3-5-9/h1-5,10,18H,6-8H2/t10-/m0/s1 |
| InChIKey | NWVDNRUPFVYITD-JTQLQIEISA-N |
| XLogP | 1.44 |
| TPSA | 55.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|