C18H27NO5Si — CID 102150396
benzyl (4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-1,3-oxazolidine-3-carboxylate (PubChem CID 102150396) has the molecular formula C18H27NO5Si and a molecular weight of 365.50 g/mol. Its IUPAC name is benzyl (4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 102150396 |
| Molecular Formula | C18H27NO5Si |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | benzyl (4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1C(=O)OCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H27NO5Si/c1-18(2,3)25(4,5)24-12-15-16(20)23-13-19(15)17(21)22-11-14-9-7-6-8-10-14/h6-10,15H,11-13H2,1-5H3/t15-/m1/s1 |
| InChIKey | JDJMGQLHONRZHZ-OAHLLOKOSA-N |
| XLogP | 3.53 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|