C29H28ClN3O4S — CID 87891552
(1R)-1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioic S-acid;N-benzyl-3-chloropropanamide (PubChem CID 87891552) has the molecular formula C29H28ClN3O4S and a molecular weight of 550.08 g/mol. Its IUPAC name is (1R)-1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioic S-acid;N-benzyl-3-chloropropanamide.
| Compound Name | (1R)-1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioic S-acid;N-benzyl-3-chloropropanamide |
|---|---|
| PubChem CID | 87891552 |
| Molecular Formula | C29H28ClN3O4S |
| Molecular Weight | 550.08 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | (1R)-1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioic S-acid;N-benzyl-3-chloropropanamide |
| SMILES | O=C(CCCl)NCc1ccccc1.O=C(S)N1CCc2c([nH]c3ccccc23)[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H16N2O3S.C10H12ClNO/c22-19(25)21-8-7-13-12-3-1-2-4-14(12)20-17(13)18(21)11-5-6-15-16(9-11)24-10-23-15;11-7-6-10(13)12-8-9-4-2-1-3-5-9/h1-6,9,18,20H,7-8,10H2,(H,22,25);1-5H,6-8H2,(H,12,13)/t18-;/m1./s1 |
| InChIKey | QSJUSYCSRABRPL-GMUIIQOCSA-N |
| XLogP | 5.83 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.08 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|