C26H22FN3O2S — CID 10298201
1-(1,3-benzodioxol-5-yl)-N-[(2-fluorophenyl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioamide (PubChem CID 10298201) has the molecular formula C26H22FN3O2S and a molecular weight of 459.55 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-[(2-fluorophenyl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioamide.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-[(2-fluorophenyl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioamide |
|---|---|
| PubChem CID | 10298201 |
| Molecular Formula | C26H22FN3O2S |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-[(2-fluorophenyl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioamide |
| SMILES | Fc1ccccc1CNC(=S)N1CCc2c([nH]c3ccccc23)C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H22FN3O2S/c27-20-7-3-1-5-17(20)14-28-26(33)30-12-11-19-18-6-2-4-8-21(18)29-24(19)25(30)16-9-10-22-23(13-16)32-15-31-22/h1-10,13,25,29H,11-12,14-15H2,(H,28,33) |
| InChIKey | DJSLPVWDQVXUQC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 49.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|