C27H25N3O2S — CID 58717148
(1R)-1-(1,3-benzodioxol-5-yl)-N-[(1S)-1-phenylethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioamide (PubChem CID 58717148) has the molecular formula C27H25N3O2S and a molecular weight of 455.58 g/mol. Its IUPAC name is (1R)-1-(1,3-benzodioxol-5-yl)-N-[(1S)-1-phenylethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioamide.
| Compound Name | (1R)-1-(1,3-benzodioxol-5-yl)-N-[(1S)-1-phenylethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioamide |
|---|---|
| PubChem CID | 58717148 |
| Molecular Formula | C27H25N3O2S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | (1R)-1-(1,3-benzodioxol-5-yl)-N-[(1S)-1-phenylethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioamide |
| SMILES | C[C@H](NC(=S)N1CCc2c([nH]c3ccccc23)[C@H]1c1ccc2c(c1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C27H25N3O2S/c1-17(18-7-3-2-4-8-18)28-27(33)30-14-13-21-20-9-5-6-10-22(20)29-25(21)26(30)19-11-12-23-24(15-19)32-16-31-23/h2-12,15,17,26,29H,13-14,16H2,1H3,(H,28,33)/t17-,26+/m0/s1 |
| InChIKey | FCTUDCYZEVZPCT-MRDQGFSESA-N |
| XLogP | 5.48 |
| TPSA | 49.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|