C23H21ClN2O5 — CID 53237229
methyl (1R,3R)-1-(1,3-benzodioxol-5-yl)-2-(2-chloroacetyl)-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 53237229) has the molecular formula C23H21ClN2O5 and a molecular weight of 440.88 g/mol. Its IUPAC name is methyl (1R,3R)-1-(1,3-benzodioxol-5-yl)-2-(2-chloroacetyl)-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (1R,3R)-1-(1,3-benzodioxol-5-yl)-2-(2-chloroacetyl)-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 53237229 |
| Molecular Formula | C23H21ClN2O5 |
| Molecular Weight | 440.88 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | methyl (1R,3R)-1-(1,3-benzodioxol-5-yl)-2-(2-chloroacetyl)-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)[C@H]1Cc2c(n(C)c3ccccc23)[C@@H](c2ccc3c(c2)OCO3)N1C(=O)CCl |
| InChI | InChI=1S/C23H21ClN2O5/c1-25-16-6-4-3-5-14(16)15-10-17(23(28)29-2)26(20(27)11-24)21(22(15)25)13-7-8-18-19(9-13)31-12-30-18/h3-9,17,21H,10-12H2,1-2H3/t17-,21-/m1/s1 |
| InChIKey | FYLAVCRQHASRQI-DYESRHJHSA-N |
| XLogP | 3.16 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.88 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|