C22H19ClN2O5 — CID 91112959
(2-chloroacetyl) (1R,3R)-1-(1,3-benzodioxol-5-yl)-9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 91112959) has the molecular formula C22H19ClN2O5 and a molecular weight of 426.86 g/mol. Its IUPAC name is (2-chloroacetyl) (1R,3R)-1-(1,3-benzodioxol-5-yl)-9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | (2-chloroacetyl) (1R,3R)-1-(1,3-benzodioxol-5-yl)-9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 91112959 |
| Molecular Formula | C22H19ClN2O5 |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | (2-chloroacetyl) (1R,3R)-1-(1,3-benzodioxol-5-yl)-9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | Cn1c2c(c3ccccc31)C[C@H](C(=O)OC(=O)CCl)N[C@@H]2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H19ClN2O5/c1-25-16-5-3-2-4-13(16)14-9-15(22(27)30-19(26)10-23)24-20(21(14)25)12-6-7-17-18(8-12)29-11-28-17/h2-8,15,20,24H,9-11H2,1H3/t15-,20-/m1/s1 |
| InChIKey | JFEJUFAQZGZRNM-FOIQADDNSA-N |
| XLogP | 2.82 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|