C24H21N3O5 — CID 21043643
(2R,8R)-17-acetyl-2-(1,3-benzodioxol-5-yl)-6-methyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 21043643) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is (2R,8R)-17-acetyl-2-(1,3-benzodioxol-5-yl)-6-methyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (2R,8R)-17-acetyl-2-(1,3-benzodioxol-5-yl)-6-methyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 21043643 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | (2R,8R)-17-acetyl-2-(1,3-benzodioxol-5-yl)-6-methyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | CC(=O)n1c2c(c3ccccc31)C[C@@H]1C(=O)N(C)CC(=O)N1[C@@H]2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H21N3O5/c1-13(28)26-17-6-4-3-5-15(17)16-10-18-24(30)25(2)11-21(29)27(18)22(23(16)26)14-7-8-19-20(9-14)32-12-31-19/h3-9,18,22H,10-12H2,1-2H3/t18-,22-/m1/s1 |
| InChIKey | MSZSQNYIMXBNMR-XMSQKQJNSA-N |
| XLogP | 2.34 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |