C23H19F2N3O4 — CID 70315813
(2R,8R)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)-6,17-dimethyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 70315813) has the molecular formula C23H19F2N3O4 and a molecular weight of 439.42 g/mol. Its IUPAC name is (2R,8R)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)-6,17-dimethyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (2R,8R)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)-6,17-dimethyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 70315813 |
| Molecular Formula | C23H19F2N3O4 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | (2R,8R)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)-6,17-dimethyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | CN1CC(=O)N2[C@H](c3ccc4c(c3)OC(F)(F)O4)c3c(c4ccccc4n3C)C[C@@H]2C1=O |
| InChI | InChI=1S/C23H19F2N3O4/c1-26-11-19(29)28-16(22(26)30)10-14-13-5-3-4-6-15(13)27(2)21(14)20(28)12-7-8-17-18(9-12)32-23(24,25)31-17/h3-9,16,20H,10-11H2,1-2H3/t16-,20-/m1/s1 |
| InChIKey | YFEWKKGUQUXOIH-OXQOHEQNSA-N |
| XLogP | 2.81 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|