C23H20N2O5 — CID 168895284
methyl (1R,3S)-1-(1,3-benzodioxol-5-yl)-6-prop-2-ynoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 168895284) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is methyl (1R,3S)-1-(1,3-benzodioxol-5-yl)-6-prop-2-ynoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (1R,3S)-1-(1,3-benzodioxol-5-yl)-6-prop-2-ynoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 168895284 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | methyl (1R,3S)-1-(1,3-benzodioxol-5-yl)-6-prop-2-ynoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | C#CCOc1ccc2[nH]c3c(c2c1)C[C@@H](C(=O)OC)N[C@@H]3c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H20N2O5/c1-3-8-28-14-5-6-17-15(10-14)16-11-18(23(26)27-2)25-21(22(16)24-17)13-4-7-19-20(9-13)30-12-29-19/h1,4-7,9-10,18,21,24-25H,8,11-12H2,2H3/t18-,21+/m0/s1 |
| InChIKey | KTHUIBRZTGMEQV-GHTZIAJQSA-N |
| XLogP | 2.69 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|