C19H17BrN2O2 — CID 66938266
methyl 6-bromo-1-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 66938266) has the molecular formula C19H17BrN2O2 and a molecular weight of 385.26 g/mol. Its IUPAC name is methyl 6-bromo-1-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 6-bromo-1-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 66938266 |
| Molecular Formula | C19H17BrN2O2 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | methyl 6-bromo-1-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)C1Cc2c([nH]c3ccc(Br)cc23)C(c2ccccc2)N1 |
| InChI | InChI=1S/C19H17BrN2O2/c1-24-19(23)16-10-14-13-9-12(20)7-8-15(13)21-18(14)17(22-16)11-5-3-2-4-6-11/h2-9,16-17,21-22H,10H2,1H3 |
| InChIKey | HAMJBGVEZYXACL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|