C23H21ClN2O5 — CID 59120480
1-[(1R,3R)-3-acetyl-1-(1,3-benzodioxol-5-yl)-7-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-chloroethanone (PubChem CID 59120480) has the molecular formula C23H21ClN2O5 and a molecular weight of 440.88 g/mol. Its IUPAC name is 1-[(1R,3R)-3-acetyl-1-(1,3-benzodioxol-5-yl)-7-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-chloroethanone.
| Compound Name | 1-[(1R,3R)-3-acetyl-1-(1,3-benzodioxol-5-yl)-7-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-chloroethanone |
|---|---|
| PubChem CID | 59120480 |
| Molecular Formula | C23H21ClN2O5 |
| Molecular Weight | 440.88 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 1-[(1R,3R)-3-acetyl-1-(1,3-benzodioxol-5-yl)-7-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-chloroethanone |
| SMILES | COc1ccc2c3c([nH]c2c1)[C@@H](c1ccc2c(c1)OCO2)N(C(=O)CCl)[C@@H](C(C)=O)C3 |
| InChI | InChI=1S/C23H21ClN2O5/c1-12(27)18-9-16-15-5-4-14(29-2)8-17(15)25-22(16)23(26(18)21(28)10-24)13-3-6-19-20(7-13)31-11-30-19/h3-8,18,23,25H,9-11H2,1-2H3/t18-,23-/m1/s1 |
| InChIKey | YJLQNCKZICWSKQ-WZONZLPQSA-N |
| XLogP | 3.58 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.88 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|