C34H34N4O6 — CID 71482879
methyl (2R,5R,8S)-4-acetyl-5-[[benzyl(phenylmethoxycarbonyl)amino]methyl]-6-oxo-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-8-carboxylate (PubChem CID 71482879) has the molecular formula C34H34N4O6 and a molecular weight of 594.67 g/mol. Its IUPAC name is methyl (2R,5R,8S)-4-acetyl-5-[[benzyl(phenylmethoxycarbonyl)amino]methyl]-6-oxo-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-8-carboxylate.
| Compound Name | methyl (2R,5R,8S)-4-acetyl-5-[[benzyl(phenylmethoxycarbonyl)amino]methyl]-6-oxo-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-8-carboxylate |
|---|---|
| PubChem CID | 71482879 |
| Molecular Formula | C34H34N4O6 |
| Molecular Weight | 594.67 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | methyl (2R,5R,8S)-4-acetyl-5-[[benzyl(phenylmethoxycarbonyl)amino]methyl]-6-oxo-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-8-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@H]2CN(C(C)=O)[C@H](CN(Cc3ccccc3)C(=O)OCc3ccccc3)C(=O)N21 |
| InChI | InChI=1S/C34H34N4O6/c1-22(39)37-20-29-31-26(25-15-9-10-16-27(25)35-31)17-28(33(41)43-2)38(29)32(40)30(37)19-36(18-23-11-5-3-6-12-23)34(42)44-21-24-13-7-4-8-14-24/h3-16,28-30,35H,17-21H2,1-2H3/t28-,29+,30+/m0/s1 |
| InChIKey | JUHKJFAJIJQFHQ-FRXPANAUSA-N |
| XLogP | 4.20 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.67 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|