C24H24ClIN4O3S — CID 139446744
[[4-[(1S,3R)-2-(2-chloroacetyl)-3-(dimethylcarbamoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]benzoyl]amino]methyl thiohypoiodite (PubChem CID 139446744) has the molecular formula C24H24ClIN4O3S and a molecular weight of 610.91 g/mol. Its IUPAC name is [[4-[(1S,3R)-2-(2-chloroacetyl)-3-(dimethylcarbamoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]benzoyl]amino]methyl thiohypoiodite.
| Compound Name | [[4-[(1S,3R)-2-(2-chloroacetyl)-3-(dimethylcarbamoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]benzoyl]amino]methyl thiohypoiodite |
|---|---|
| PubChem CID | 139446744 |
| Molecular Formula | C24H24ClIN4O3S |
| Molecular Weight | 610.91 g/mol |
| Exact Mass | 610.03 |
| IUPAC Name | [[4-[(1S,3R)-2-(2-chloroacetyl)-3-(dimethylcarbamoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]benzoyl]amino]methyl thiohypoiodite |
| SMILES | CN(C)C(=O)[C@H]1Cc2c([nH]c3ccccc23)[C@H](c2ccc(C(=O)NCSI)cc2)N1C(=O)CCl |
| InChI | InChI=1S/C24H24ClIN4O3S/c1-29(2)24(33)19-11-17-16-5-3-4-6-18(16)28-21(17)22(30(19)20(31)12-25)14-7-9-15(10-8-14)23(32)27-13-34-26/h3-10,19,22,28H,11-13H2,1-2H3,(H,27,32)/t19-,22+/m1/s1 |
| InChIKey | RVRJBNULTUWOJG-KNQAVFIVSA-N |
| XLogP | 4.11 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.91 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|