C23H23ClN2O2 — CID 139446951
2-chloro-1-[(1S,3S)-3-methyl-1-[4-(oxetan-3-yl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanone (PubChem CID 139446951) has the molecular formula C23H23ClN2O2 and a molecular weight of 394.90 g/mol. Its IUPAC name is 2-chloro-1-[(1S,3S)-3-methyl-1-[4-(oxetan-3-yl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanone.
| Compound Name | 2-chloro-1-[(1S,3S)-3-methyl-1-[4-(oxetan-3-yl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanone |
|---|---|
| PubChem CID | 139446951 |
| Molecular Formula | C23H23ClN2O2 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 2-chloro-1-[(1S,3S)-3-methyl-1-[4-(oxetan-3-yl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanone |
| SMILES | C[C@H]1Cc2c([nH]c3ccccc23)[C@H](c2ccc(C3COC3)cc2)N1C(=O)CCl |
| InChI | InChI=1S/C23H23ClN2O2/c1-14-10-19-18-4-2-3-5-20(18)25-22(19)23(26(14)21(27)11-24)16-8-6-15(7-9-16)17-12-28-13-17/h2-9,14,17,23,25H,10-13H2,1H3/t14-,23-/m0/s1 |
| InChIKey | JEKBVDJDVBAAMZ-PSLXWICFSA-N |
| XLogP | 4.38 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|