C23H25ClFN3O — CID 165078795
2-chloro-1-[(1S)-3-[1-(ethylamino)ethyl]-1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanone (PubChem CID 165078795) has the molecular formula C23H25ClFN3O and a molecular weight of 413.92 g/mol. Its IUPAC name is 2-chloro-1-[(1S)-3-[1-(ethylamino)ethyl]-1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanone.
| Compound Name | 2-chloro-1-[(1S)-3-[1-(ethylamino)ethyl]-1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanone |
|---|---|
| PubChem CID | 165078795 |
| Molecular Formula | C23H25ClFN3O |
| Molecular Weight | 413.92 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 2-chloro-1-[(1S)-3-[1-(ethylamino)ethyl]-1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanone |
| SMILES | CCNC(C)C1Cc2c([nH]c3ccccc23)[C@H](c2ccc(F)cc2)N1C(=O)CCl |
| InChI | InChI=1S/C23H25ClFN3O/c1-3-26-14(2)20-12-18-17-6-4-5-7-19(17)27-22(18)23(28(20)21(29)13-24)15-8-10-16(25)11-9-15/h4-11,14,20,23,26-27H,3,12-13H2,1-2H3/t14?,20?,23-/m0/s1 |
| InChIKey | UTQVHUSFWUWUAW-JLWCKEOGSA-N |
| XLogP | 4.39 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.92 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|