C22H21ClIN3O2S — CID 139446910
[4-[(1S,3R)-2-(2-chloroacetyl)-3-(dimethylcarbamoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl] thiohypoiodite (PubChem CID 139446910) has the molecular formula C22H21ClIN3O2S and a molecular weight of 553.85 g/mol. Its IUPAC name is [4-[(1S,3R)-2-(2-chloroacetyl)-3-(dimethylcarbamoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl] thiohypoiodite.
| Compound Name | [4-[(1S,3R)-2-(2-chloroacetyl)-3-(dimethylcarbamoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl] thiohypoiodite |
|---|---|
| PubChem CID | 139446910 |
| Molecular Formula | C22H21ClIN3O2S |
| Molecular Weight | 553.85 g/mol |
| Exact Mass | 553.01 |
| IUPAC Name | [4-[(1S,3R)-2-(2-chloroacetyl)-3-(dimethylcarbamoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl] thiohypoiodite |
| SMILES | CN(C)C(=O)[C@H]1Cc2c([nH]c3ccccc23)[C@H](c2ccc(SI)cc2)N1C(=O)CCl |
| InChI | InChI=1S/C22H21ClIN3O2S/c1-26(2)22(29)18-11-16-15-5-3-4-6-17(15)25-20(16)21(27(18)19(28)12-23)13-7-9-14(30-24)10-8-13/h3-10,18,21,25H,11-12H2,1-2H3/t18-,21+/m1/s1 |
| InChIKey | VNUTTZDRRWCFPF-NQIIRXRSSA-N |
| XLogP | 4.78 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.85 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|