C24H26FN3O2 — CID 139446534
2-fluoro-1-[(1S,3S)-3-methyl-1-(4-morpholin-4-ylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanone (PubChem CID 139446534) has the molecular formula C24H26FN3O2 and a molecular weight of 407.49 g/mol. Its IUPAC name is 2-fluoro-1-[(1S,3S)-3-methyl-1-(4-morpholin-4-ylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanone.
| Compound Name | 2-fluoro-1-[(1S,3S)-3-methyl-1-(4-morpholin-4-ylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanone |
|---|---|
| PubChem CID | 139446534 |
| Molecular Formula | C24H26FN3O2 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 2-fluoro-1-[(1S,3S)-3-methyl-1-(4-morpholin-4-ylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanone |
| SMILES | C[C@H]1Cc2c([nH]c3ccccc23)[C@H](c2ccc(N3CCOCC3)cc2)N1C(=O)CF |
| InChI | InChI=1S/C24H26FN3O2/c1-16-14-20-19-4-2-3-5-21(19)26-23(20)24(28(16)22(29)15-25)17-6-8-18(9-7-17)27-10-12-30-13-11-27/h2-9,16,24,26H,10-15H2,1H3/t16-,24-/m0/s1 |
| InChIKey | AESCEQMQUXILCD-FYSMJZIKSA-N |
| XLogP | 3.84 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|