C23H24N4O3 — CID 139431881
(1S,3S)-1-[6-(cyclobutylcarbamoyl)-3-pyridinyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylic acid (PubChem CID 139431881) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is (1S,3S)-1-[6-(cyclobutylcarbamoyl)-3-pyridinyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylic acid.
| Compound Name | (1S,3S)-1-[6-(cyclobutylcarbamoyl)-3-pyridinyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 139431881 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (1S,3S)-1-[6-(cyclobutylcarbamoyl)-3-pyridinyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylic acid |
| SMILES | C[C@H]1Cc2c([nH]c3ccccc23)[C@H](c2ccc(C(=O)NC3CCC3)nc2)N1C(=O)O |
| InChI | InChI=1S/C23H24N4O3/c1-13-11-17-16-7-2-3-8-18(16)26-20(17)21(27(13)23(29)30)14-9-10-19(24-12-14)22(28)25-15-5-4-6-15/h2-3,7-10,12-13,15,21,26H,4-6,11H2,1H3,(H,25,28)(H,29,30)/t13-,21-/m0/s1 |
| InChIKey | WCACQSNFIIRSQV-ZSEKCTLFSA-N |
| XLogP | 3.86 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|