C25H25ClN4O2 — CID 139446619
(1S,3S)-2-(2-chloroacetyl)-3-methyl-1-(4-morpholin-4-ylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-6-carbonitrile (PubChem CID 139446619) has the molecular formula C25H25ClN4O2 and a molecular weight of 448.95 g/mol. Its IUPAC name is (1S,3S)-2-(2-chloroacetyl)-3-methyl-1-(4-morpholin-4-ylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-6-carbonitrile.
| Compound Name | (1S,3S)-2-(2-chloroacetyl)-3-methyl-1-(4-morpholin-4-ylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-6-carbonitrile |
|---|---|
| PubChem CID | 139446619 |
| Molecular Formula | C25H25ClN4O2 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (1S,3S)-2-(2-chloroacetyl)-3-methyl-1-(4-morpholin-4-ylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-6-carbonitrile |
| SMILES | C[C@H]1Cc2c([nH]c3ccc(C#N)cc23)[C@H](c2ccc(N3CCOCC3)cc2)N1C(=O)CCl |
| InChI | InChI=1S/C25H25ClN4O2/c1-16-12-21-20-13-17(15-27)2-7-22(20)28-24(21)25(30(16)23(31)14-26)18-3-5-19(6-4-18)29-8-10-32-11-9-29/h2-7,13,16,25,28H,8-12,14H2,1H3/t16-,25-/m0/s1 |
| InChIKey | BNUQAURPFZHILU-LMKMVOKYSA-N |
| XLogP | 3.98 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|