C32H36ClN3O3S — CID 163970096
4-[(1S,3S)-2-(2-chloroacetyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(1R,3S,5R)-5-methyl-1-tetracyclo[5.3.1.03,9.05,9]undecanyl]benzenesulfonamide (PubChem CID 163970096) has the molecular formula C32H36ClN3O3S and a molecular weight of 578.18 g/mol. Its IUPAC name is 4-[(1S,3S)-2-(2-chloroacetyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(1R,3S,5R)-5-methyl-1-tetracyclo[5.3.1.03,9.05,9]undecanyl]benzenesulfonamide.
| Compound Name | 4-[(1S,3S)-2-(2-chloroacetyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(1R,3S,5R)-5-methyl-1-tetracyclo[5.3.1.03,9.05,9]undecanyl]benzenesulfonamide |
|---|---|
| PubChem CID | 163970096 |
| Molecular Formula | C32H36ClN3O3S |
| Molecular Weight | 578.18 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | 4-[(1S,3S)-2-(2-chloroacetyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(1R,3S,5R)-5-methyl-1-tetracyclo[5.3.1.03,9.05,9]undecanyl]benzenesulfonamide |
| SMILES | C[C@H]1Cc2c([nH]c3ccccc23)[C@H](c2ccc(S(=O)(=O)N[C@@]34CC5CC6(C3)[C@H](C4)C[C@@]6(C)C5)cc2)N1C(=O)CCl |
| InChI | InChI=1S/C32H36ClN3O3S/c1-19-11-25-24-5-3-4-6-26(24)34-28(25)29(36(19)27(37)17-33)21-7-9-23(10-8-21)40(38,39)35-31-13-20-12-30(2)15-22(16-31)32(30,14-20)18-31/h3-10,19-20,22,29,34-35H,11-18H2,1-2H3/t19-,20?,22-,29-,30+,31+,32?/m0/s1 |
| InChIKey | SPGHKQQIIPZMQE-WJVLQXLZSA-N |
| XLogP | 5.91 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.18 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|