C33H38ClN3O — CID 164823362
1-[(1S,3S)-1-[4-(1-adamantylamino)phenyl]-3-(cyclopropylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-chloroethanone (PubChem CID 164823362) has the molecular formula C33H38ClN3O and a molecular weight of 528.14 g/mol. Its IUPAC name is 1-[(1S,3S)-1-[4-(1-adamantylamino)phenyl]-3-(cyclopropylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-chloroethanone.
| Compound Name | 1-[(1S,3S)-1-[4-(1-adamantylamino)phenyl]-3-(cyclopropylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-chloroethanone |
|---|---|
| PubChem CID | 164823362 |
| Molecular Formula | C33H38ClN3O |
| Molecular Weight | 528.14 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | 1-[(1S,3S)-1-[4-(1-adamantylamino)phenyl]-3-(cyclopropylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-chloroethanone |
| SMILES | O=C(CCl)N1[C@@H](CC2CC2)Cc2c([nH]c3ccccc23)[C@@H]1c1ccc(NC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C33H38ClN3O/c34-19-30(38)37-26(14-20-5-6-20)15-28-27-3-1-2-4-29(27)35-31(28)32(37)24-7-9-25(10-8-24)36-33-16-21-11-22(17-33)13-23(12-21)18-33/h1-4,7-10,20-23,26,32,35-36H,5-6,11-19H2/t21?,22?,23?,26-,32-,33?/m0/s1 |
| InChIKey | ZBWLKMXBKNCGEC-NHUFWROJSA-N |
| XLogP | 7.43 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.14 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|