C33H41N3O2 — CID 175988743
1-[(1S,3S)-1-[4-(1-adamantylamino)phenyl]-3-butyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-hydroxyethanone (PubChem CID 175988743) has the molecular formula C33H41N3O2 and a molecular weight of 511.71 g/mol. Its IUPAC name is 1-[(1S,3S)-1-[4-(1-adamantylamino)phenyl]-3-butyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-hydroxyethanone.
| Compound Name | 1-[(1S,3S)-1-[4-(1-adamantylamino)phenyl]-3-butyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 175988743 |
| Molecular Formula | C33H41N3O2 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.32 |
| IUPAC Name | 1-[(1S,3S)-1-[4-(1-adamantylamino)phenyl]-3-butyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-hydroxyethanone |
| SMILES | CCCC[C@H]1Cc2c([nH]c3ccccc23)[C@H](c2ccc(NC34CC5CC(CC(C5)C3)C4)cc2)N1C(=O)CO |
| InChI | InChI=1S/C33H41N3O2/c1-2-3-6-26-16-28-27-7-4-5-8-29(27)34-31(28)32(36(26)30(38)20-37)24-9-11-25(12-10-24)35-33-17-21-13-22(18-33)15-23(14-21)19-33/h4-5,7-12,21-23,26,32,34-35,37H,2-3,6,13-20H2,1H3/t21?,22?,23?,26-,32-,33?/m0/s1 |
| InChIKey | SFPWWXPHYUCFOL-NHUFWROJSA-N |
| XLogP | 6.57 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|