C29H31N3O3 — CID 139431806
(1S,3R)-1-[4-(1-adamantylcarbamoyl)phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 139431806) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is (1S,3R)-1-[4-(1-adamantylcarbamoyl)phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | (1S,3R)-1-[4-(1-adamantylcarbamoyl)phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 139431806 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | (1S,3R)-1-[4-(1-adamantylcarbamoyl)phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1ccc([C@@H]2N[C@@H](C(=O)O)Cc3c2[nH]c2ccccc32)cc1 |
| InChI | InChI=1S/C29H31N3O3/c33-27(32-29-13-16-9-17(14-29)11-18(10-16)15-29)20-7-5-19(6-8-20)25-26-22(12-24(31-25)28(34)35)21-3-1-2-4-23(21)30-26/h1-8,16-18,24-25,30-31H,9-15H2,(H,32,33)(H,34,35)/t16?,17?,18?,24-,25+,29?/m1/s1 |
| InChIKey | IABHLWKEAWDQOQ-MWWBIVQESA-N |
| XLogP | 4.55 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|