C36H45N3O4 — CID 171054112
2-[[(1S,3S)-1-[4-(1-adamantylamino)phenyl]-3-butyl-2-prop-2-ynoyl-3,4-dihydro-1H-isoquinolin-6-yl]oxy]ethyl 2-aminoacetate (PubChem CID 171054112) has the molecular formula C36H45N3O4 and a molecular weight of 583.77 g/mol. Its IUPAC name is 2-[[(1S,3S)-1-[4-(1-adamantylamino)phenyl]-3-butyl-2-prop-2-ynoyl-3,4-dihydro-1H-isoquinolin-6-yl]oxy]ethyl 2-aminoacetate.
| Compound Name | 2-[[(1S,3S)-1-[4-(1-adamantylamino)phenyl]-3-butyl-2-prop-2-ynoyl-3,4-dihydro-1H-isoquinolin-6-yl]oxy]ethyl 2-aminoacetate |
|---|---|
| PubChem CID | 171054112 |
| Molecular Formula | C36H45N3O4 |
| Molecular Weight | 583.77 g/mol |
| Exact Mass | 583.34 |
| IUPAC Name | 2-[[(1S,3S)-1-[4-(1-adamantylamino)phenyl]-3-butyl-2-prop-2-ynoyl-3,4-dihydro-1H-isoquinolin-6-yl]oxy]ethyl 2-aminoacetate |
| SMILES | C#CC(=O)N1[C@@H](CCCC)Cc2cc(OCCOC(=O)CN)ccc2[C@@H]1c1ccc(NC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C36H45N3O4/c1-3-5-6-30-18-28-19-31(42-13-14-43-34(41)23-37)11-12-32(28)35(39(30)33(40)4-2)27-7-9-29(10-8-27)38-36-20-24-15-25(21-36)17-26(16-24)22-36/h2,7-12,19,24-26,30,35,38H,3,5-6,13-18,20-23,37H2,1H3/t24?,25?,26?,30-,35-,36?/m0/s1 |
| InChIKey | YSFLMFYTDISGTP-ODERQLABSA-N |
| XLogP | 5.61 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.77 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|