C25H32N2O2Si — CID 155617954
1-[(1R,3S)-3-butyl-6-methoxy-1-pyridin-2-yl-3,4-dihydro-1H-isoquinolin-2-yl]-3-trimethylsilylprop-2-yn-1-one (PubChem CID 155617954) has the molecular formula C25H32N2O2Si and a molecular weight of 420.63 g/mol. Its IUPAC name is 1-[(1R,3S)-3-butyl-6-methoxy-1-pyridin-2-yl-3,4-dihydro-1H-isoquinolin-2-yl]-3-trimethylsilylprop-2-yn-1-one.
| Compound Name | 1-[(1R,3S)-3-butyl-6-methoxy-1-pyridin-2-yl-3,4-dihydro-1H-isoquinolin-2-yl]-3-trimethylsilylprop-2-yn-1-one |
|---|---|
| PubChem CID | 155617954 |
| Molecular Formula | C25H32N2O2Si |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 1-[(1R,3S)-3-butyl-6-methoxy-1-pyridin-2-yl-3,4-dihydro-1H-isoquinolin-2-yl]-3-trimethylsilylprop-2-yn-1-one |
| SMILES | CCCC[C@H]1Cc2cc(OC)ccc2[C@H](c2ccccn2)N1C(=O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C25H32N2O2Si/c1-6-7-10-20-17-19-18-21(29-2)12-13-22(19)25(23-11-8-9-15-26-23)27(20)24(28)14-16-30(3,4)5/h8-9,11-13,15,18,20,25H,6-7,10,17H2,1-5H3/t20-,25+/m0/s1 |
| InChIKey | CTAWCSOUPLKHQR-NBGIEHNGSA-N |
| XLogP | 5.00 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|