C35H46N2O2Si — CID 171054148
1-[(1S,3S)-1-[4-(1-adamantylamino)phenyl]-6-methoxy-3-propyl-3,4-dihydro-1H-isoquinolin-2-yl]-3-trimethylsilylprop-2-yn-1-one (PubChem CID 171054148) has the molecular formula C35H46N2O2Si and a molecular weight of 554.85 g/mol. Its IUPAC name is 1-[(1S,3S)-1-[4-(1-adamantylamino)phenyl]-6-methoxy-3-propyl-3,4-dihydro-1H-isoquinolin-2-yl]-3-trimethylsilylprop-2-yn-1-one.
| Compound Name | 1-[(1S,3S)-1-[4-(1-adamantylamino)phenyl]-6-methoxy-3-propyl-3,4-dihydro-1H-isoquinolin-2-yl]-3-trimethylsilylprop-2-yn-1-one |
|---|---|
| PubChem CID | 171054148 |
| Molecular Formula | C35H46N2O2Si |
| Molecular Weight | 554.85 g/mol |
| Exact Mass | 554.33 |
| IUPAC Name | 1-[(1S,3S)-1-[4-(1-adamantylamino)phenyl]-6-methoxy-3-propyl-3,4-dihydro-1H-isoquinolin-2-yl]-3-trimethylsilylprop-2-yn-1-one |
| SMILES | CCC[C@H]1Cc2cc(OC)ccc2[C@H](c2ccc(NC34CC5CC(CC(C5)C3)C4)cc2)N1C(=O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C35H46N2O2Si/c1-6-7-30-19-28-20-31(39-2)12-13-32(28)34(37(30)33(38)14-15-40(3,4)5)27-8-10-29(11-9-27)36-35-21-24-16-25(22-35)18-26(17-24)23-35/h8-13,20,24-26,30,34,36H,6-7,16-19,21-23H2,1-5H3/t24?,25?,26?,30-,34-,35?/m0/s1 |
| InChIKey | CRJXSIBIVVUJRR-HWBLTXSRSA-N |
| XLogP | 7.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.85 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|