C34H40N2O2 — CID 171053965
1-[(1S,3R)-1-[4-(1-adamantylamino)phenyl]-3-cyclopentyl-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-yn-1-one (PubChem CID 171053965) has the molecular formula C34H40N2O2 and a molecular weight of 508.71 g/mol. Its IUPAC name is 1-[(1S,3R)-1-[4-(1-adamantylamino)phenyl]-3-cyclopentyl-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-yn-1-one.
| Compound Name | 1-[(1S,3R)-1-[4-(1-adamantylamino)phenyl]-3-cyclopentyl-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 171053965 |
| Molecular Formula | C34H40N2O2 |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.31 |
| IUPAC Name | 1-[(1S,3R)-1-[4-(1-adamantylamino)phenyl]-3-cyclopentyl-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-yn-1-one |
| SMILES | C#CC(=O)N1[C@@H](c2ccc(NC34CC5CC(CC(C5)C3)C4)cc2)c2ccc(OC)cc2C[C@@H]1C1CCCC1 |
| InChI | InChI=1S/C34H40N2O2/c1-3-32(37)36-31(25-6-4-5-7-25)18-27-17-29(38-2)12-13-30(27)33(36)26-8-10-28(11-9-26)35-34-19-22-14-23(20-34)16-24(15-22)21-34/h1,8-13,17,22-25,31,33,35H,4-7,14-16,18-21H2,2H3/t22?,23?,24?,31-,33+,34?/m1/s1 |
| InChIKey | YYAJPNPVQSCCQH-TXEPKCICSA-N |
| XLogP | 6.74 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|