C26H28N4O3 — CID 155138354
1-[(1S,3R)-3-(butylamino)-6-methoxy-1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-yn-1-one (PubChem CID 155138354) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is 1-[(1S,3R)-3-(butylamino)-6-methoxy-1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-yn-1-one.
| Compound Name | 1-[(1S,3R)-3-(butylamino)-6-methoxy-1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 155138354 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 1-[(1S,3R)-3-(butylamino)-6-methoxy-1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-yn-1-one |
| SMILES | C#CC(=O)N1[C@@H](c2ccc(-c3nc(C)no3)cc2)c2ccc(OC)cc2C[C@@H]1NCCCC |
| InChI | InChI=1S/C26H28N4O3/c1-5-7-14-27-23-16-20-15-21(32-4)12-13-22(20)25(30(23)24(31)6-2)18-8-10-19(11-9-18)26-28-17(3)29-33-26/h2,8-13,15,23,25,27H,5,7,14,16H2,1,3-4H3/t23-,25+/m1/s1 |
| InChIKey | VTFMJUODECVQEI-NOZRDPDXSA-N |
| XLogP | 3.88 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|