C28H31N3O2 — CID 171053915
1-[(1S,3S)-3-butyl-1-[4-(cyclobutylamino)-3-isocyanophenyl]-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-yn-1-one (PubChem CID 171053915) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is 1-[(1S,3S)-3-butyl-1-[4-(cyclobutylamino)-3-isocyanophenyl]-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-yn-1-one.
| Compound Name | 1-[(1S,3S)-3-butyl-1-[4-(cyclobutylamino)-3-isocyanophenyl]-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 171053915 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 1-[(1S,3S)-3-butyl-1-[4-(cyclobutylamino)-3-isocyanophenyl]-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-yn-1-one |
| SMILES | [C-]#[N+]c1cc([C@H]2c3ccc(OC)cc3C[C@H](CCCC)N2C(=O)C#C)ccc1NC1CCC1 |
| InChI | InChI=1S/C28H31N3O2/c1-5-7-11-22-16-20-17-23(33-4)13-14-24(20)28(31(22)27(32)6-2)19-12-15-25(26(18-19)29-3)30-21-9-8-10-21/h2,12-15,17-18,21-22,28,30H,5,7-11,16H2,1,4H3/t22-,28-/m0/s1 |
| InChIKey | VSKPLQLIDADTMQ-DWACAAAGSA-N |
| XLogP | 5.88 |
| TPSA | 45.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|