C36H46N2O2Si — CID 163932842
1-[(1R,3R)-1-[4-(1-adamantylamino)phenyl]-3-cyclobutyl-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]-3-trimethylsilylprop-2-yn-1-one (PubChem CID 163932842) has the molecular formula C36H46N2O2Si and a molecular weight of 566.86 g/mol. Its IUPAC name is 1-[(1R,3R)-1-[4-(1-adamantylamino)phenyl]-3-cyclobutyl-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]-3-trimethylsilylprop-2-yn-1-one.
| Compound Name | 1-[(1R,3R)-1-[4-(1-adamantylamino)phenyl]-3-cyclobutyl-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]-3-trimethylsilylprop-2-yn-1-one |
|---|---|
| PubChem CID | 163932842 |
| Molecular Formula | C36H46N2O2Si |
| Molecular Weight | 566.86 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | 1-[(1R,3R)-1-[4-(1-adamantylamino)phenyl]-3-cyclobutyl-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]-3-trimethylsilylprop-2-yn-1-one |
| SMILES | COc1ccc2c(c1)C[C@H](C1CCC1)N(C(=O)C#C[Si](C)(C)C)[C@@H]2c1ccc(NC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C36H46N2O2Si/c1-40-31-12-13-32-29(19-31)20-33(27-6-5-7-27)38(34(39)14-15-41(2,3)4)35(32)28-8-10-30(11-9-28)37-36-21-24-16-25(22-36)18-26(17-24)23-36/h8-13,19,24-27,33,35,37H,5-7,16-18,20-23H2,1-4H3/t24?,25?,26?,33-,35-,36?/m1/s1 |
| InChIKey | RKDTWCBVRLJFNW-DZDLXESQSA-N |
| XLogP | 7.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.86 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|