C23H31N3O3 — CID 7406171
(2R)-2-N-(1-adamantyl)-1-N-(3-methoxyphenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 7406171) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is (2R)-2-N-(1-adamantyl)-1-N-(3-methoxyphenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R)-2-N-(1-adamantyl)-1-N-(3-methoxyphenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 7406171 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | (2R)-2-N-(1-adamantyl)-1-N-(3-methoxyphenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | COc1cccc(NC(=O)N2CCC[C@@H]2C(=O)NC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C23H31N3O3/c1-29-19-5-2-4-18(11-19)24-22(28)26-7-3-6-20(26)21(27)25-23-12-15-8-16(13-23)10-17(9-15)14-23/h2,4-5,11,15-17,20H,3,6-10,12-14H2,1H3,(H,24,28)(H,25,27)/t15?,16?,17?,20-,23?/m1/s1 |
| InChIKey | NCOKLZMITKAOFC-LZGZYFLISA-N |
| XLogP | 3.78 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |