C16H21N3O3 — CID 4998458
1-N-(3-methoxyphenyl)-2-N-prop-2-enylpyrrolidine-1,2-dicarboxamide (PubChem CID 4998458) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 1-N-(3-methoxyphenyl)-2-N-prop-2-enylpyrrolidine-1,2-dicarboxamide.
| Compound Name | 1-N-(3-methoxyphenyl)-2-N-prop-2-enylpyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 4998458 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-N-(3-methoxyphenyl)-2-N-prop-2-enylpyrrolidine-1,2-dicarboxamide |
| SMILES | C=CCNC(=O)C1CCCN1C(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C16H21N3O3/c1-3-9-17-15(20)14-8-5-10-19(14)16(21)18-12-6-4-7-13(11-12)22-2/h3-4,6-7,11,14H,1,5,8-10H2,2H3,(H,17,20)(H,18,21) |
| InChIKey | FLQWPSKMANALRZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|