C27H30INO — CID 171053999
(1S,3S)-2-benzyl-3-butyl-1-(3-iodophenyl)-6-methoxy-3,4-dihydro-1H-isoquinoline (PubChem CID 171053999) has the molecular formula C27H30INO and a molecular weight of 511.45 g/mol. Its IUPAC name is (1S,3S)-2-benzyl-3-butyl-1-(3-iodophenyl)-6-methoxy-3,4-dihydro-1H-isoquinoline.
| Compound Name | (1S,3S)-2-benzyl-3-butyl-1-(3-iodophenyl)-6-methoxy-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 171053999 |
| Molecular Formula | C27H30INO |
| Molecular Weight | 511.45 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | (1S,3S)-2-benzyl-3-butyl-1-(3-iodophenyl)-6-methoxy-3,4-dihydro-1H-isoquinoline |
| SMILES | CCCC[C@H]1Cc2cc(OC)ccc2[C@H](c2cccc(I)c2)N1Cc1ccccc1 |
| InChI | InChI=1S/C27H30INO/c1-3-4-13-24-17-22-18-25(30-2)14-15-26(22)27(21-11-8-12-23(28)16-21)29(24)19-20-9-6-5-7-10-20/h5-12,14-16,18,24,27H,3-4,13,17,19H2,1-2H3/t24-,27-/m0/s1 |
| InChIKey | FAIYGRSXJYZLPC-IGKIAQTJSA-N |
| XLogP | 7.01 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.45 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|