C41H50N4O2S — CID 170731938
[3-butyl-1-[4-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)amino]phenyl]-6-(3-hydroxypropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(2-ethynyl-1,3-thiazol-4-yl)methanone (PubChem CID 170731938) has the molecular formula C41H50N4O2S and a molecular weight of 662.94 g/mol. Its IUPAC name is [3-butyl-1-[4-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)amino]phenyl]-6-(3-hydroxypropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(2-ethynyl-1,3-thiazol-4-yl)methanone.
| Compound Name | [3-butyl-1-[4-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)amino]phenyl]-6-(3-hydroxypropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(2-ethynyl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 170731938 |
| Molecular Formula | C41H50N4O2S |
| Molecular Weight | 662.94 g/mol |
| Exact Mass | 662.37 |
| IUPAC Name | [3-butyl-1-[4-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)amino]phenyl]-6-(3-hydroxypropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(2-ethynyl-1,3-thiazol-4-yl)methanone |
| SMILES | C#Cc1nc(C(=O)N2C(CCCC)Cc3c([nH]c4ccc(CCCO)cc34)C2c2ccc(NC3(C)CC4CC(C)CC(C4)C3)cc2)cs1 |
| InChI | InChI=1S/C41H50N4O2S/c1-5-7-10-32-22-34-33-21-27(9-8-17-46)11-16-35(33)43-38(34)39(45(32)40(47)36-25-48-37(6-2)42-36)30-12-14-31(15-13-30)44-41(4)23-28-18-26(3)19-29(20-28)24-41/h2,11-16,21,25-26,28-29,32,39,43-44,46H,5,7-10,17-20,22-24H2,1,3-4H3 |
| InChIKey | FGYCZXRNLMECPR-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.94 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|