C25H26N2O3 — CID 139446530
1-[(1S,3S)-3-butyl-1-(2-hydroxy-6-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-yn-1-one (PubChem CID 139446530) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is 1-[(1S,3S)-3-butyl-1-(2-hydroxy-6-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-yn-1-one.
| Compound Name | 1-[(1S,3S)-3-butyl-1-(2-hydroxy-6-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 139446530 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 1-[(1S,3S)-3-butyl-1-(2-hydroxy-6-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-yn-1-one |
| SMILES | C#CC(=O)N1[C@@H](CCCC)Cc2c([nH]c3ccccc23)[C@@H]1c1c(O)cccc1OC |
| InChI | InChI=1S/C25H26N2O3/c1-4-6-10-16-15-18-17-11-7-8-12-19(17)26-24(18)25(27(16)22(29)5-2)23-20(28)13-9-14-21(23)30-3/h2,7-9,11-14,16,25-26,28H,4,6,10,15H2,1,3H3/t16-,25-/m0/s1 |
| InChIKey | JACDYSGVSUDDMX-LMKMVOKYSA-N |
| XLogP | 4.55 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|